| Name |
N,Na(2)-[[2,2,2-Trifluoro-1-(trifluoromethyl)ethylidene]bis(4,1-phenyleneoxy-4,1-phenylene)]bis[N-(2-oxiranylmethyl)-2-oxiranemethanamine]
|
| Molecular Formula |
C39H36F6N2O6
|
| Molecular Weight |
742.7
|
| Smiles |
FC(F)(F)C(c1ccc(Oc2ccc(N(CC3CO3)CC3CO3)cc2)cc1)(c1ccc(Oc2ccc(N(CC3CO3)CC3CO3)cc2)cc1)C(F)(F)F
|
FC(F)(F)C(c1ccc(Oc2ccc(N(CC3CO3)CC3CO3)cc2)cc1)(c1ccc(Oc2ccc(N(CC3CO3)CC3CO3)cc2)cc1)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.