| Name |
2-{[4-(bromomethyl)-1H-1,2,3-triazol-1-yl]methyl}-4-methoxy-3,5-dimethylpyridine
|
| Molecular Formula |
C12H15BrN4O
|
| Molecular Weight |
311.18
|
| Smiles |
COc1c(C)cnc(Cn2cc(CBr)nn2)c1C
|
COc1c(C)cnc(Cn2cc(CBr)nn2)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.