| Name |
N-[(2-methoxyphenyl)methyl]-4-{9-phenyl-2,4,5,7,8,10-hexaazatetracyclo[10.4.0.0^{2,6}.0^{7,11}]hexadeca-1(16),3,5,8,10,12,14-heptaen-3-yl}butanamide
|
| Molecular Formula |
C28H35N7O2
|
| Molecular Weight |
501.6
|
| Smiles |
COc1ccccc1CNC(=O)CCCc1nnc2n1C1CCCCC1C1NC(c3ccccc3)NN21
|
COc1ccccc1CNC(=O)CCCc1nnc2n1C1CCCCC1C1NC(c3ccccc3)NN21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.