| Name |
9-Fluoro-6-methoxy-3-(2,2,2-trifluoroacetyl)-2,3,4,5-tetrahydro-1H-benzo[d]azepine
|
| Molecular Formula |
C13H13F4NO2
|
| Molecular Weight |
291.24
|
| Smiles |
COc1ccc(F)c2c1CCN(C(=O)C(F)(F)F)CC2
|
COc1ccc(F)c2c1CCN(C(=O)C(F)(F)F)CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.