| Name |
N-(1-{5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl}piperidin-4-yl)methanesulfonamide
|
| Molecular Formula |
C12H18N6O2S
|
| Molecular Weight |
310.38
|
| Smiles |
Cc1cc(N2CCC(NS(C)(=O)=O)CC2)n2ncnc2n1
|
Cc1cc(N2CCC(NS(C)(=O)=O)CC2)n2ncnc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.