| Name |
methyl 2-(5-amino-1H-1,2,4-triazol-3-yl)benzoate hydrochloride
|
| Molecular Formula |
C10H11ClN4O2
|
| Molecular Weight |
254.67
|
| Smiles |
COC(=O)c1ccccc1-c1nc(N)n[nH]1.Cl
|
COC(=O)c1ccccc1-c1nc(N)n[nH]1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.