| Name |
5-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)benzo[c][1,2,5]thiadiazole
|
| Molecular Formula |
C11H13BN2O2S
|
| Molecular Weight |
248.11
|
| Smiles |
CC1(C)COB(c2ccc3nsnc3c2)OC1
|
CC1(C)COB(c2ccc3nsnc3c2)OC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.