| Name |
{1-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]cyclohexyl}amine
|
| Molecular Formula |
C15H19N3O2
|
| Molecular Weight |
273.33
|
| Smiles |
COc1ccc(-c2noc(C3(N)CCCCC3)n2)cc1
|
COc1ccc(-c2noc(C3(N)CCCCC3)n2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.