| Name |
N-(3,4-dimethylphenyl)-5-oxo-1-thioxo-4,5-dihydro-1H-[1,3]dioxolo[4,5-g]thiazolo[3,4-a]quinazoline-3-carboxamide
|
| Molecular Formula |
C20H15N3O4S2
|
| Molecular Weight |
425.5
|
| Smiles |
Cc1ccc(NC(=O)c2sc(=S)n3c2[nH]c(=O)c2cc4c(cc23)OCO4)cc1C
|
Cc1ccc(NC(=O)c2sc(=S)n3c2[nH]c(=O)c2cc4c(cc23)OCO4)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.