| Name |
N-(1-((3r,5r,7r)-adamantan-1-yl)ethyl)-3-(5-oxo-4-propyl-4,5-dihydrothieno[2,3-e][1,2,4]triazolo[4,3-a]pyrimidin-1-yl)propanamide
|
| Molecular Formula |
C25H33N5O2S
|
| Molecular Weight |
467.6
|
| Smiles |
CCCn1c(=O)c2sccc2n2c(CCC(=O)NC(C)C34CC5CC(CC(C5)C3)C4)nnc12
|
CCCn1c(=O)c2sccc2n2c(CCC(=O)NC(C)C34CC5CC(CC(C5)C3)C4)nnc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.