| Name |
1-(5-Chloro-2-methoxyphenyl)-3-[5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-yl]urea
|
| Molecular Formula |
C16H15ClN4O4
|
| Molecular Weight |
362.77
|
| Smiles |
COc1ccc(Cl)cc1NC(=O)Nc1nnc(-c2cc(C)oc2C)o1
|
COc1ccc(Cl)cc1NC(=O)Nc1nnc(-c2cc(C)oc2C)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.