| Name |
N-(5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-yl)-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxamide
|
| Molecular Formula |
C17H15N3O5
|
| Molecular Weight |
341.32
|
| Smiles |
Cc1cc(-c2nnc(NC(=O)c3ccc4c(c3)OCCO4)o2)c(C)o1
|
Cc1cc(-c2nnc(NC(=O)c3ccc4c(c3)OCCO4)o2)c(C)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.