| Name |
3,5-Dibromo-1-[(2,6-difluorophenyl)methyl]-1H-1,2,4-triazole
|
| Molecular Formula |
C9H5Br2F2N3
|
| Molecular Weight |
352.96
|
| Smiles |
Fc1cccc(F)c1Cn1nc(Br)nc1Br
|
Fc1cccc(F)c1Cn1nc(Br)nc1Br
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.