| Name |
5-Bromo-4-fluoro-2,3-methylenedioxyphenylboronic acid, pinacol ester
|
| Molecular Formula |
C13H15BBrFO4
|
| Molecular Weight |
344.97
|
| Smiles |
CC1(C)OB(c2cc(Br)c(F)c3c2OCO3)OC1(C)C
|
CC1(C)OB(c2cc(Br)c(F)c3c2OCO3)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.