| Name |
4-(5-bromo-1H-pyrrolo[2,3-b]pyridine-3-yl)-phenol
|
| Molecular Formula |
C13H9BrN2O
|
| Molecular Weight |
289.13
|
| Smiles |
Oc1ccc(-c2c[nH]c3ncc(Br)cc23)cc1
|
Oc1ccc(-c2c[nH]c3ncc(Br)cc23)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.