| Name |
15,18-Etheno-2,6:9,13-dimetheno-1,14-benzodioxacyclodocosin-12,24-diol, 22-bromo-7,8,19,20-tetrahydro-
|
| Molecular Formula |
C28H23BrO4
|
| Molecular Weight |
503.4
|
| Smiles |
Oc1ccc2cc1Oc1ccc(cc1)CCc1cc(Br)cc(O)c1Oc1cccc(c1)CC2
|
Oc1ccc2cc1Oc1ccc(cc1)CCc1cc(Br)cc(O)c1Oc1cccc(c1)CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.