| Name |
2-[(1S,2S,3R,5S,6R)-3-(diaminomethylideneamino)-4-[(2R,4R,5S)-3-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-3-(hydroxyamino)-6-(hydroxymethyl)oxan-2-yl]oxy-4-formyl-4-hydroxy-5-methyloxolan-2-yl]oxy-2,5,6-trihydroxycyclohexyl]guanidine
|
| Molecular Formula |
C20H37N7O13
|
| Molecular Weight |
583.5
|
| Smiles |
CC1OC(OC2C(O)C(O)C(N=C(N)N)C(O)C2N=C(N)N)C(OC2OC(CO)C(O)C(O)C2NO)C1(O)C=O
|
CC1OC(OC2C(O)C(O)C(N=C(N)N)C(O)C2N=C(N)N)C(OC2OC(CO)C(O)C(O)C2NO)C1(O)C=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.