| Name |
Ethyl 1-(2,4-dimethoxybenzyl)-6,6-dimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-3-carboxylate
|
| Molecular Formula |
C22H27NO5
|
| Molecular Weight |
385.5
|
| Smiles |
CCOC(=O)c1cn(Cc2ccc(OC)cc2OC)c2c1C(=O)CC(C)(C)C2
|
CCOC(=O)c1cn(Cc2ccc(OC)cc2OC)c2c1C(=O)CC(C)(C)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.