| Name |
5-{6-bromo-4H-imidazo[4,5-b]pyridin-2-yl}quinoline
|
| Molecular Formula |
C15H9BrN4
|
| Molecular Weight |
325.16
|
| Smiles |
Brc1cnc2nc(-c3cccc4ncccc34)[nH]c2c1
|
Brc1cnc2nc(-c3cccc4ncccc34)[nH]c2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.