| Name |
4-butyl-1-((2-chlorobenzyl)thio)thieno[2,3-e][1,2,4]triazolo[4,3-a]pyrimidin-5(4H)-one
|
| Molecular Formula |
C18H17ClN4OS2
|
| Molecular Weight |
404.9
|
| Smiles |
CCCCn1c(=O)c2sccc2n2c(SCc3ccccc3Cl)nnc12
|
CCCCn1c(=O)c2sccc2n2c(SCc3ccccc3Cl)nnc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.