| Name |
5-[2-(1,3-Dihydro-1-hydroxy-2,1-benzoxaborol-7-yl)ethyl]-2,4-thiazolidinedione
|
| Molecular Formula |
C12H12BNO4S
|
| Molecular Weight |
277.11
|
| Smiles |
O=C1NC(=O)C(CCc2cccc3c2B(O)OC3)S1
|
O=C1NC(=O)C(CCc2cccc3c2B(O)OC3)S1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.