| Name |
ethyl 4-methyl-2-({[4-phenyl-2-(1H-pyrrol-1-yl)-1,3-thiazol-5-yl]carbonyl}amino)-1,3-thiazole-5-carboxylate
|
| Molecular Formula |
C21H18N4O3S2
|
| Molecular Weight |
438.5
|
| Smiles |
CCOC(=O)c1sc(NC(=O)c2sc(-n3cccc3)nc2-c2ccccc2)nc1C
|
CCOC(=O)c1sc(NC(=O)c2sc(-n3cccc3)nc2-c2ccccc2)nc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.