| Name |
(2S)-2-({[(1,1-dimethylethyl)(diphenyl)silyl]oxy}methyl)-1,2,3,6-tetrahydropyridine
|
| Molecular Formula |
C22H29NOSi
|
| Molecular Weight |
351.6
|
| Smiles |
CC(C)(C)[Si](OCC1CC=CCN1)(c1ccccc1)c1ccccc1
|
CC(C)(C)[Si](OCC1CC=CCN1)(c1ccccc1)c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.