| Name |
2-hydroxymethyl-5,6-dihydro-8H-[1,2,4]triazolo[1,5-a]pyrazine-7-carboxylic acid tert-butyl ester
|
| Molecular Formula |
C11H18N4O3
|
| Molecular Weight |
254.29
|
| Smiles |
CC(C)(C)OC(=O)N1CCn2nc(CO)nc2C1
|
CC(C)(C)OC(=O)N1CCn2nc(CO)nc2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.