| Name |
1-(2-chloro-4-fluorobenzyl)-5-(3,5-difluorophenyl)-1H-1,2,3-triazole-4-carboxylic acid
|
| Molecular Formula |
C16H9ClF3N3O2
|
| Molecular Weight |
367.71
|
| Smiles |
O=C(O)c1nnn(Cc2ccc(F)cc2Cl)c1-c1cc(F)cc(F)c1
|
O=C(O)c1nnn(Cc2ccc(F)cc2Cl)c1-c1cc(F)cc(F)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.