| Name |
3-(4-Chlorophenyl)-1-(3,4-dimethylbenzoyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione
|
| Molecular Formula |
C23H23ClN2OS
|
| Molecular Weight |
411.0
|
| Smiles |
Cc1ccc(C(=O)N2C(=S)C(c3ccc(Cl)cc3)=NC23CCCCC3)cc1C
|
Cc1ccc(C(=O)N2C(=S)C(c3ccc(Cl)cc3)=NC23CCCCC3)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.