Name | 4-hydroxy-2-oxo-1H-quinoline-3-carbonitrile |
---|---|
Synonyms |
3-cyano-4-hydroxyquinoline-2-one
3-cyano-4-hydroxyquinolin-2(1H)-one InChI=1/C10H6N2O2/c11-5-7-9(13)6-3-1-2-4-8(6)12-10(7)14/h1-4H,(H2,12,13,14 2-hydroxy-4-oxo-1H-quinoline-3-carbonitrile 4-hydroxy-2-oxo-1,2-dihydro-quinoline-3-carbonitrile 3-cyano-4-hydroxy-2(1H)-quinolinone 3-Cyanoquinoline-2,4-dione 4-hydroxy-2-oxo-1,2-dihydroquinolin-3-carbonitrile F1607-0001 2H-3-cyano-4-hydroxyquinolin-2-one |
Density | 1.47g/cm3 |
---|---|
Boiling Point | 304.6ºC at 760mmHg |
Molecular Formula | C10H6N2O2 |
Molecular Weight | 186.16700 |
Flash Point | 138ºC |
Exact Mass | 186.04300 |
PSA | 76.88000 |
LogP | 1.10538 |
Vapour Pressure | 0.000378mmHg at 25°C |
Index of Refraction | 1.686 |
HS Code | 2933499090 |
---|
Precursor 9 | |
---|---|
DownStream 1 | |
HS Code | 2933499090 |
---|---|
Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |