| Name |
1-oxo-1-(3-oxo-3,4-dihydro-2H-1,4-benzoxazin-6-yl)propan-2-yl 2,6-dichloropyridine-3-carboxylate
|
| Molecular Formula |
C17H12Cl2N2O5
|
| Molecular Weight |
395.2
|
| Smiles |
CC(OC(=O)c1ccc(Cl)nc1Cl)C(=O)c1ccc2c(c1)NC(=O)CO2
|
CC(OC(=O)c1ccc(Cl)nc1Cl)C(=O)c1ccc2c(c1)NC(=O)CO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.