| Name |
Ethyl 4-(2-cyano-3-{4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl}prop-2-enamido)benzoate
|
| Molecular Formula |
C25H23N3O5
|
| Molecular Weight |
445.5
|
| Smiles |
CCOC(=O)c1ccc(NC(=O)C(C#N)=Cc2ccc(OCc3c(C)noc3C)cc2)cc1
|
CCOC(=O)c1ccc(NC(=O)C(C#N)=Cc2ccc(OCc3c(C)noc3C)cc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.