| Name |
(11bR)-2,6-bis(3,5-difluorophenyl)-3,3,5,5-tetraoxide-dinaphtho[2,1-d:1',2'-f][1,3,2]dithiazepine
|
| Molecular Formula |
C32H17F4NO4S2
|
| Molecular Weight |
619.6
|
| Smiles |
O=S1(=O)NS(=O)(=O)c2c(-c3cc(F)cc(F)c3)cc3ccccc3c2-c2c1c(-c1cc(F)cc(F)c1)cc1ccccc21
|
O=S1(=O)NS(=O)(=O)c2c(-c3cc(F)cc(F)c3)cc3ccccc3c2-c2c1c(-c1cc(F)cc(F)c1)cc1ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.