| Name |
2-(4-Bromophenyl)-4-({[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methyl}thio)pyrazolo[1,5-a]pyrazine
|
| Molecular Formula |
C24H19BrN4OS
|
| Molecular Weight |
491.4
|
| Smiles |
Cc1cccc(-c2nc(CSc3nccn4nc(-c5ccc(Br)cc5)cc34)c(C)o2)c1
|
Cc1cccc(-c2nc(CSc3nccn4nc(-c5ccc(Br)cc5)cc34)c(C)o2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.