| Name |
2-(2,4-Dimethylphenyl)-4-{[3-(trifluoromethyl)benzyl]thio}pyrazolo[1,5-a]pyrazine
|
| Molecular Formula |
C22H18F3N3S
|
| Molecular Weight |
413.5
|
| Smiles |
Cc1ccc(-c2cc3c(SCc4cccc(C(F)(F)F)c4)nccn3n2)c(C)c1
|
Cc1ccc(-c2cc3c(SCc4cccc(C(F)(F)F)c4)nccn3n2)c(C)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.