| Name |
N-(4-acetylphenyl)-2-{[6-methyl-3-(4-methylphenyl)-7-oxo-6,7-dihydroisothiazolo[4,5-d]pyrimidin-5-yl]thio}acetamide
|
| Molecular Formula |
C19H12F2N4O2
|
| Molecular Weight |
366.3
|
| Smiles |
Cc1ccccc1-c1noc(-c2nn(-c3ccc(F)c(F)c3)ccc2=O)n1
|
Cc1ccccc1-c1noc(-c2nn(-c3ccc(F)c(F)c3)ccc2=O)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.