| Name |
Methyl 3-(2-{5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-oxo-1,2-dihydropyridin-1-yl}acetamido)thiophene-2-carboxylate
|
| Molecular Formula |
C22H18N4O6S
|
| Molecular Weight |
466.5
|
| Smiles |
COC(=O)c1sccc1NC(=O)Cn1cc(-c2nc(-c3ccc(OC)cc3)no2)ccc1=O
|
COC(=O)c1sccc1NC(=O)Cn1cc(-c2nc(-c3ccc(OC)cc3)no2)ccc1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.