| Name |
4-{[3-(4-isobutoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}-2H-1,4-benzoxazin-3(4H)-one
|
| Molecular Formula |
C21H21N3O4
|
| Molecular Weight |
379.4
|
| Smiles |
CC(C)COc1ccc(-c2noc(CN3C(=O)COc4ccccc43)n2)cc1
|
CC(C)COc1ccc(-c2noc(CN3C(=O)COc4ccccc43)n2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.