| Name |
3,4-dimethoxy-N~1~-[5-(3-methoxypropyl)-1,4,5,6-tetrahydro-1,3,5-triazin-2-yl]-1-benzenesulfonamide
|
| Molecular Formula |
C15H24N4O5S
|
| Molecular Weight |
372.4
|
| Smiles |
COCCCN1CN=C(NS(=O)(=O)c2ccc(OC)c(OC)c2)NC1
|
COCCCN1CN=C(NS(=O)(=O)c2ccc(OC)c(OC)c2)NC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.