| Name |
2'-(2-methoxyethyl)-N-(4-methoxyphenyl)-1'-oxo-1',4'-dihydro-2'H-spiro[cyclopentane-1,3'-isoquinoline]-4'-carboxamide
|
| Molecular Formula |
C24H28N2O4
|
| Molecular Weight |
408.5
|
| Smiles |
COCCN1C(=O)c2ccccc2C(C(=O)Nc2ccc(OC)cc2)C12CCCC2
|
COCCN1C(=O)c2ccccc2C(C(=O)Nc2ccc(OC)cc2)C12CCCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.