| Name |
4-(2,6-Dichloropyridin-3-yl)-2,7,7-trimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carbonitrile
|
| Molecular Formula |
C18H17Cl2N3O
|
| Molecular Weight |
362.2
|
| Smiles |
CC1=C(C#N)C(c2ccc(Cl)nc2Cl)C2=C(CC(C)(C)CC2=O)N1
|
CC1=C(C#N)C(c2ccc(Cl)nc2Cl)C2=C(CC(C)(C)CC2=O)N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.