| Name |
2-Amino-7-(4-methoxyphenyl)[1,3]thiazolo[4,5-d]pyridazin-4(5H)-one
|
| Molecular Formula |
C12H10N4O2S
|
| Molecular Weight |
274.30
|
| Smiles |
COc1ccc(-c2n[nH]c(=O)c3nc(N)sc23)cc1
|
COc1ccc(-c2n[nH]c(=O)c3nc(N)sc23)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.