| Name |
1-(4-Fluorophenyl)-4,4-dimethylpentan-3-one
|
| Molecular Formula |
C13H17FO
|
| Molecular Weight |
208.27
|
| Smiles |
CC(C)(C)C(=O)CCc1ccc(F)cc1
|
CC(C)(C)C(=O)CCc1ccc(F)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.