| Name |
(E)-N-(5-ethyl-3,3-dimethyl-4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]oxazepin-8-yl)-2-phenylethenesulfonamide
|
| Molecular Formula |
C21H24N2O4S
|
| Molecular Weight |
400.5
|
| Smiles |
CCN1C(=O)C(C)(C)COc2cc(NS(=O)(=O)C=Cc3ccccc3)ccc21
|
CCN1C(=O)C(C)(C)COc2cc(NS(=O)(=O)C=Cc3ccccc3)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.