| Name |
N-(2-methoxyphenyl)-2-{[2-(2-{[(2-methoxyphenyl)methyl]carbamoyl}ethyl)-3-oxo-2H,3H-imidazo[1,2-c]quinazolin-5-yl]sulfanyl}butanamide
|
| Molecular Formula |
C32H33N5O5S
|
| Molecular Weight |
599.7
|
| Smiles |
CCC(SC1=Nc2ccccc2C2=NC(CCC(=O)NCc3ccccc3OC)C(=O)N12)C(=O)Nc1ccccc1OC
|
CCC(SC1=Nc2ccccc2C2=NC(CCC(=O)NCc3ccccc3OC)C(=O)N12)C(=O)Nc1ccccc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.