| Name |
1-(3,5-Dimethylphenyl)-3-{3-[4-(propan-2-yloxy)phenyl]-1,2,4-oxadiazol-5-yl}-1,4-dihydropyridazin-4-one
|
| Molecular Formula |
C23H22N4O3
|
| Molecular Weight |
402.4
|
| Smiles |
Cc1cc(C)cc(-n2ccc(=O)c(-c3nc(-c4ccc(OC(C)C)cc4)no3)n2)c1
|
Cc1cc(C)cc(-n2ccc(=O)c(-c3nc(-c4ccc(OC(C)C)cc4)no3)n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.