| Name |
methyl 4-({[8-(2-methylphenoxy)-3-oxo[1,2,4]triazolo[4,3-a]pyrazin-2(3H)-yl]acetyl}amino)benzoate
|
| Molecular Formula |
C22H19N5O5
|
| Molecular Weight |
433.4
|
| Smiles |
COC(=O)c1ccc(NC(=O)Cn2nc3c(Oc4ccccc4C)nccn3c2=O)cc1
|
COC(=O)c1ccc(NC(=O)Cn2nc3c(Oc4ccccc4C)nccn3c2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.