| Name |
1-(2,4-Dimethoxyphenyl)-2,2-difluoroethan-1-amine
|
| Molecular Formula |
C10H13F2NO2
|
| Molecular Weight |
217.21
|
| Smiles |
COc1ccc(C(N)C(F)F)c(OC)c1
|
COc1ccc(C(N)C(F)F)c(OC)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.