| Name |
N1-[1-(2,6-Difluorophenyl)ethyl]-3-ethyl-N2,N2-dimethyl-1,2-pentanediamine
|
| Molecular Formula |
C17H28F2N2
|
| Molecular Weight |
298.4
|
| Smiles |
CCC(CC)C(CNC(C)c1c(F)cccc1F)N(C)C
|
CCC(CC)C(CNC(C)c1c(F)cccc1F)N(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.