| Name |
4-(1,1-dioxido-6-(trifluoromethyl)-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazin-3-yl)-N-isopentylbenzamide
|
| Molecular Formula |
C20H22F3N3O3S
|
| Molecular Weight |
441.5
|
| Smiles |
CC(C)CCNC(=O)c1ccc(C2Nc3cc(C(F)(F)F)ccc3S(=O)(=O)N2)cc1
|
CC(C)CCNC(=O)c1ccc(C2Nc3cc(C(F)(F)F)ccc3S(=O)(=O)N2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.