| Name |
N-(3-(benzo[d]thiazol-2-yl)-6-ethyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl)-2-((4-methoxyphenyl)thio)acetamide hydrochloride
|
| Molecular Formula |
C25H26ClN3O2S3
|
| Molecular Weight |
532.1
|
| Smiles |
CCN1CCc2c(sc(NC(=O)CSc3ccc(OC)cc3)c2-c2nc3ccccc3s2)C1.Cl
|
CCN1CCc2c(sc(NC(=O)CSc3ccc(OC)cc3)c2-c2nc3ccccc3s2)C1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.