| Name |
7-chloro-3-hydroxy-3-{2-[4-(methylsulfanyl)phenyl]-2-oxoethyl}-1,3-dihydro-2H-indol-2-one
|
| Molecular Formula |
C17H14ClNO3S
|
| Molecular Weight |
347.8
|
| Smiles |
CSc1ccc(C(=O)CC2(O)C(=O)Nc3c(Cl)cccc32)cc1
|
CSc1ccc(C(=O)CC2(O)C(=O)Nc3c(Cl)cccc32)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.