| Name |
(3aS,6aR)-5-(4,6-dimethylpyrimidin-2-yl)-3-(2-piperidin-1-ylethyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-2-one
|
| Molecular Formula |
C18H27N5O2
|
| Molecular Weight |
345.4
|
| Smiles |
Cc1cc(C)nc(N2CC3OC(=O)N(CCN4CCCCC4)C3C2)n1
|
Cc1cc(C)nc(N2CC3OC(=O)N(CCN4CCCCC4)C3C2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.